ImazalilSolutioninMethanol , 1000 μg/mlinmethanol, uncertainty: 2% , 35554-44-0
Synonym(s):
1-[2-(Allyloxy)-2-(2,4-dichlorophenyl)ethyl]imidazole;Imazalil
CAS NO.:35554-44-0
Empirical Formula: C14H14Cl2N2O
Molecular Weight: 297.18
MDL number: MFCD00055331
EINECS: 252-615-0
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB287.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 52.7°C |
| Boiling point: | >340°C |
| Density | 1.348 |
| vapor pressure | 1.58 x l0-4 Pa (20 °C) |
| refractive index | 1.5680 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform: Slightly Soluble; Methanol: Slightly Soluble |
| pka | 6.53 (weak base) |
| form | Solid |
| color | Light yellow to yellow |
| Water Solubility | 0.018 g/100 mL |
| Merck | 13,3616 |
| BRN | 545683 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2 |
| InChIKey | PZBPKYOVPCNPJY-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCC=C)c(Cl)c1 |
| LogP | 3.820 |
| CAS DataBase Reference | 35554-44-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Imazalil(35554-44-0) |
| EPA Substance Registry System | Imazalil (35554-44-0) |
Description and Uses
Imazalil is an imidazole fungicide that inhibits ergosterol biosynthesis. Imazalil inhibits the growth of various fungi in vitro including P. italicum, A. niger, U. maydis, B. alii, and C. cucumerinum in a pH-dependent manner (MICs = 0.005-2 μg/ml at pH 7). It inhibits S. cerevisiae, but not rat liver microsomal, cytochrome P450 enzymes (CYPs; IC50s = 0.088 and 80 μM, respectively), as well as aromatase CYP19 from human placental microsomes (IC50 = 0.34 μM). Imazalil activates the murine pregnane X receptor (PXR) in a concentration-dependent manner in a cell-based reporter assay. It increases hepatic CYP3A11 and CYP2B10 mRNA levels in mice when administered at a dose of 100 mg/kg. Imazalil also increases Ki-67-positive nuclei in liver sections and hepatic MCM2 mRNA levels, markers of cell proliferation, in mice when co-administered with the murine constitutive androstane receptor (mCAR) agonist TCPOBOP . Formulations containing imazalil have been used to control fungal infection in agriculture.
antifungal
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H318-H332-H410 |
| Precautionary statements | P261-P273-P280-P301+P310-P304+P340+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 20/22-41-50/53 |
| Safety Statements | 26-39-60-61 |
| RIDADR | 2588 |
| WGK Germany | 3 |
| RTECS | NI4776000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Chronic 1 Carc. 2 Eye Dam. 1 |
| Hazardous Substances Data | 35554-44-0(Hazardous Substances Data) |









