A0563456
DiflufenicanSolutioninAcetonitrile , 100 μg/mlinetonitrile, uncertainty of 3%
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB63.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110°C |
| Boiling point: | 376.2±42.0 °C(Predicted) |
| Density | 1.4301 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Acetone (Slightly), Chloroform (Slightly), DMSO (Slightly), Ethanol (Slightly), |
| pka | 9.03±0.70(Predicted) |
| form | Solid |
| color | Off-White |
| Merck | 14,3144 |
| BRN | 4212494 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C19H11F5N2O2/c20-12-6-7-16(15(21)10-12)26-17(27)14-5-2-8-25-18(14)28-13-4-1-3-11(9-13)19(22,23)24/h1-10H,(H,26,27) |
| InChIKey | WYEHFWKAOXOVJD-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=CC(C(F)(F)F)=C2)=NC=CC=C1C(NC1=CC=C(F)C=C1F)=O |
| LogP | 4.900 |
| CAS DataBase Reference | 83164-33-4(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Pyridinecarboxamide, N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]- (83164-33-4) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H412 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352+P312 |
| PPE | Eyeshields, Gloves |
| Risk Statements | 52/53 |
| Safety Statements | 61 |
| RIDADR | UN3077(solid); UN3082 (liquid) |
| WGK Germany | 2 |
| RTECS | US4589800 |
| HS Code | 2933.39.2500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity | LD50 in mice, rats (mg/kg): >1000, >2000 orally; in rats (mg/kg): >2000 dermally (Cramp) |







