A0565056
4',5,7-trimethoxyflavone , 98% , 5631-70-9
Synonym(s):
4′,5,7-Apigenin trimethyl ether;4′,5,7-Trimethylapigenin;5,7-Dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB879.20 | In Stock |
|
| 500mg | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160°C (dec.) |
| Boiling point: | 506.5±50.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| form | Solid |
| color | Light yellow to yellow |
| InChI | InChI=1S/C18H16O5/c1-20-12-6-4-11(5-7-12)15-10-14(19)18-16(22-3)8-13(21-2)9-17(18)23-15/h4-10H,1-3H3 |
| InChIKey | ZXJJBDHPUHUUHD-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OC)C=C2)OC2=CC(OC)=CC(OC)=C2C(=O)C=1 |
| LogP | 3.530 (est) |
Description and Uses
4'',5,7-Trimethoxyflavone is significantly effective at inhibiting proliferation of SNU-16 human gastric cancer cells in a concentration dependent manner.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |







