A7344112
Sinensetin , 98% , 2306-27-6
Synonym(s):
2-(3,4-Dimethoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one;2-(3,4-Dimethoxyphenyl)-5,6,7-trimethoxychromen-4-one;3′,4′,5,6,7-Pentamethoxyflavone;6-Hydroxyluteolin 5,6,7,3′,4′-pentamethyl ether;Pedalitin permethyl ether
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB407.20 | In Stock |
|
| 25MG | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-176°C |
| Boiling point: | 547.8±50.0 °C(Predicted) |
| Density | 1.244±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble3mg/mL, clear (warmed) |
| form | powder |
| color | white to beige |
| BRN | 345748 |
| InChI | 1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(27-14)10-17(24-3)19(25-4)20(18)26-5/h6-10H,1-5H3 |
| InChIKey | LKMNXYDUQXAUCZ-UHFFFAOYSA-N |
| SMILES | O=C1C=C(C2=CC(OC)=C(OC)C=C2)OC3=C1C(OC)=C(OC)C(OC)=C3 |
| LogP | 2.634 (est) |
| CAS DataBase Reference | 2306-27-6(CAS DataBase Reference) |
Description and Uses
Sinensetin exhibits anti-fungal, anti-histamine activity; induce cell differentiation, inhibition of linoleic acid oxidation, inhibition of white blood cells in the human zona protein Interleukin -1-i nduced expression of tissue factor.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS02 |
| Signal word | Warning |
| Hazard statements | H315-H319-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P337+P313-P305+P351+P338-P362+P364-P303+P361+P353-P332+P313-P403+P235 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 22-24/25-45 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |







