A4842712
5-Hydroxyflavone , >98.0%(HPLC) , 491-78-1
Synonym(s):
5-Hydroxy-2-phenylchromone;NSC 26745;Primuletin
CAS NO.:491-78-1
Empirical Formula: C15H10O3
Molecular Weight: 238.24
MDL number: MFCD00016944
EINECS: 207-743-1
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB91.20 | In Stock |
|
| 100mg | RMB175.20 | In Stock |
|
| 250mg | RMB264.80 | In Stock |
|
| 500mg | RMB423.20 | In Stock |
|
| 1G | RMB783.20 | In Stock |
|
| 5g | RMB3028.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160°C |
| Boiling point: | 425.0±45.0 °C(Predicted) |
| Density | 1.340±0.06 g/cm3(Predicted) |
| pka | 6.76±0.40(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 194429 |
| InChI | 1S/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| InChIKey | IYBLVRRCNVHZQJ-UHFFFAOYSA-N |
| SMILES | Oc1cccc2OC(=CC(=O)c12)c3ccccc3 |
| LogP | 4.300 |
| CAS DataBase Reference | 491-78-1(CAS DataBase Reference) |
Description and Uses
Reactant involved in:• ;Condensation reactions for synthesis of copper(II) complexes as bioactive molecules to combat antioxidants1• ;Thermal behavior studies of vanadyl complexes with flavone derivatives in terms of insulin-mimetic agents2• ;O-methylation with di-Me carbonate3• ;DFT studies on excited-state intramolecular proton transfer4
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39-27-37 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |





