A0600112
                    β-Alanine ethyl ester hydrochloride , 98% , 4244-84-2
                            Synonym(s):
Ethyl 3-aminopropionate hydrochloride
                            
                        
                CAS NO.:4244-84-2
Empirical Formula: C5H12ClNO2
Molecular Weight: 153.61
MDL number: MFCD00012909
EINECS: 224-203-0
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB23.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB64.00 | In Stock | 
                                                 | 
                                        
| 100G | RMB184.00 | In Stock | 
                                                 | 
                                        
| 500G | RMB566.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 67-70 °C(lit.) | 
                                    
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature | 
                                    
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | 
                                    
| form | Crystalline Powder | 
                                    
| color | White to off-white | 
                                    
| Water Solubility | almost transparency | 
                                    
| Sensitive | Hygroscopic | 
                                    
| BRN | 3559095 | 
                                    
| InChI | InChI=1S/C5H11NO2.ClH/c1-2-8-5(7)3-4-6;/h2-4,6H2,1H3;1H | 
                                    
| InChIKey | RJCGNNHKSNIUAT-UHFFFAOYSA-N | 
                                    
| SMILES | C(=O)(OCC)CCN.Cl | 
                                    
| CAS DataBase Reference | 4244-84-2(CAS DataBase Reference) | 
                                    
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319 | 
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 36/37/39-26-22-36-24/25 | 
| WGK Germany | 3 | 
| HazardClass | HYGROSCOPIC | 
| HS Code | 29224995 | 






