A0600112
β-Alanine ethyl ester hydrochloride , 98% , 4244-84-2
Synonym(s):
Ethyl 3-aminopropionate hydrochloride
CAS NO.:4244-84-2
Empirical Formula: C5H12ClNO2
Molecular Weight: 153.61
MDL number: MFCD00012909
EINECS: 224-203-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB184.00 | In Stock |
|
| 500G | RMB566.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-70 °C(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | almost transparency |
| Sensitive | Hygroscopic |
| BRN | 3559095 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H11NO2.ClH/c1-2-8-5(7)3-4-6;/h2-4,6H2,1H3;1H |
| InChIKey | RJCGNNHKSNIUAT-UHFFFAOYSA-N |
| SMILES | C(=O)(OCC)CCN.Cl |
| CAS DataBase Reference | 4244-84-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36/37/39-26-22-36-24/25 |
| WGK Germany | 3 |
| HazardClass | HYGROSCOPIC |
| HS Code | 29224995 |
| Storage Class | 11 - Combustible Solids |






