A7034258
β-Alaninemethylesterhydrochloride , 10mMinDMSO , 3196-73-4
Synonym(s):
Methyl 3-aminopropionate hydrochloride
CAS NO.:3196-73-4
Empirical Formula: C4H10ClNO2
Molecular Weight: 139.58
MDL number: MFCD00039060
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-105 °C |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Crystalline Powder |
| color | White to off-white |
| Sensitive | Hygroscopic |
| BRN | 3556748 |
| InChI | InChI=1S/C4H9NO2.ClH/c1-7-4(6)2-3-5;/h2-3,5H2,1H3;1H |
| InChIKey | XPGRZDJXVKFLHQ-UHFFFAOYSA-N |
| SMILES | C(=O)(OC)CCN.Cl |
| CAS DataBase Reference | 3196-73-4(CAS DataBase Reference) |
Description and Uses
β-Alanine Methyl Ester is an intermediate in the synthesis of Trichostatin A (T774710) and Trapoxin B as histone deacetylase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |







