A0600556
trans-Di(μ-acetato)bis[o-(di-o-tolylphosphino)benzyl]dipalladium(II) , 97%[cataCXium?C] , 172418-32-5
Synonym(s):
Herrmann-Beller catalyst;Herrmann-Beller palladacycle;trans-Di-μ-acetatobis[2-[bis(2-methylphenyl)phosphino]benzyl]dipalladium;trans-Di(μ-acetato)bis[o-(di-o-tolyl-phosphino)benzyl]dipalladium(II);cataCXium C
CAS NO.:172418-32-5
Empirical Formula: 2C23H23O2PPd
Molecular Weight: 937.65
MDL number: MFCD01075746
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB303.20 | In Stock |
|
| 1g | RMB583.20 | In Stock |
|
| 5g | RMB2303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| color | yellow |
| InChI | 1S/2C21H20P.2C2H4O2.2Pd/c2*1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3;2*1-2(3)4;;/h2*4-15H,1H2,2-3H3;2*1H3,(H,3,4);;/q;;;;2*+1/p-2 |
| InChIKey | DUHUARWWBNTVDI-UHFFFAOYSA-L |
| SMILES | CC(=O)O[Pd]Cc1ccccc1P(c2ccccc2C)c3ccccc3C.CC(=O)O[Pd]Cc4ccccc4P(c5ccccc5C)c6ccccc6C |
Description and Uses
trans-Bis(acetato)bis[o-(di-o-tolylphosphino)benzyl]dipalladium(II) is a useful catalyst for C-C and C-N cross coupling reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |

![trans-Di(μ-acetato)bis[o-(di-o-tolylphosphino)benzyl]dipalladium(II)](https://img.chemicalbook.com/CAS/GIF/172418-32-5.gif)


