N-Acetylneuraminic acid , 98% , 131-48-6
Synonym(s):
NAN;Sialic acid;NANA;Lactaminic acid;NANA, Lactaminic Acid, Sialic Acid
CAS NO.:131-48-6
Empirical Formula: C11H19NO9
Molecular Weight: 309.27
MDL number: MFCD00006620
EINECS: 205-023-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB23.20 | In Stock |
|
| 250MG | RMB28.00 | In Stock |
|
| 1G | RMB40.80 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB400.00 | In Stock |
|
| 100G | RMB1495.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 184-186 °C |
| alpha | -32 º (c=2,water) |
| Boiling point: | 449.56°C (rough estimate) |
| Density | 1.3580 (rough estimate) |
| refractive index | -32 ° (C=1, H2O) |
| storage temp. | -20°C |
| solubility | 50 g/L (20°C) |
| pka | 2.41±0.54(Predicted) |
| form | synthetic, crystalline |
| color | White to Off-White |
| biological source | synthetic |
| optical activity | -32 |
| Water Solubility | 50 g/L (20 ºC) |
| Sensitive | Air Sensitive |
| Merck | 14,8484 |
| BRN | 1716283 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING SKIN PROTECTING |
| InChI | 1S/C11H19NO9/c1-4(14)12-7-5(15)2-11(20,10(18)19)21-9(7)8(17)6(16)3-13/h5-9,13,15-17,20H,2-3H2,1H3,(H,12,14)(H,18,19)/t5-,6+,7+,8+,9+,11-/m0/s1 |
| InChIKey | SQVRNKJHWKZAKO-PFQGKNLYSA-N |
| SMILES | O[C@@]1(O[C@@]([C@@H]([C@H](C1)O)NC(C)=O)([H])[C@@H]([C@@H](CO)O)O)C(O)=O |
| LogP | -1.897 (est) |
| CAS DataBase Reference | 131-48-6(CAS DataBase Reference) |
| EPA Substance Registry System | Neuraminic acid, N-acetyl- (131-48-6) |
Description and Uses
N-acetylneuraminic acid is an N-acyl derivative of neuraminic or acid amino sugar derivative, derived from N-acetylmannosamine and pyruvic acid. It is an important constituent of glycoproteins and glycolipids. N-acetylneuraminic acid occurs in many polysaccharides, glycoproteins, and glycolipids in animals and bacteria.
N-Acetylneuraminic acid is an integral part of sialic acids (SAs), important functional sugars that play an important role in maintaining and improving brain health, detoxification, antibacterial, and immune enhancement. n-Acetylneuraminic acid is biologically useful for neurotransmission, leukocyte extravasation, viral or bacterial infection, and carbohydrate-protein recognition. n- Acetylneuraminic acid is used to study its biochemistry, metabolism and absorption in vivo and in vitro.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10-23 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29329970 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |



![(S)-5-[[Bis(Boc-amino)methylene]amino]-2-(Fmoc-amino)pentanoicAcid](https://img.chemicalbook.com/CAS/GIF/143824-77-5.gif)

