A0604012
2-Amino-5-chlorobenzophenone , 98% , 719-59-5
Synonym(s):
2-Amino-5-chlorobenzophenone;4-Chloro-2-benzoylaniline;5-Chloro-2-aminobenzophenone
CAS NO.：719-59-5
Empirical Formula: C13H10ClNO
Molecular Weight: 231.68
MDL number: MFCD00007839
EINECS: 211-949-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB80.00 | In Stock |
|
| 500G | RMB324.00 | In Stock |
|
| 2.5kg | RMB1198.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-98 °C (lit.) |
| Boiling point: | 207 °C |
| Density | 1.33 |
| vapor pressure | 0-1Pa at 20-25℃ |
| refractive index | 1.6000 (estimate) |
| Flash point: | 211 °C |
| storage temp. | Store below +30°C. |
| solubility | Solubility in methanol gives very faint turbidity. Soluble in DMSO. |
| pka | 0.06±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| BRN | 475640 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C13H10ClNO/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8H,15H2 |
| InChIKey | ZUWXHHBROGLWNH-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)cc1C(=O)c2ccccc2 |
| LogP | 3.16 at 21℃ and pH7 |
| CAS DataBase Reference | 719-59-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzophenone, 2-amino-5-chloro-(719-59-5) |
| EPA Substance Registry System | Methanone, (2-amino-5-chlorophenyl)phenyl- (719-59-5) |
Description and Uses
It is used in the heterocyclic syntheses based on the reactions of dimethyl acetylenedicarboxylate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | PC4933500 |
| TSCA | TSCA listed |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity | LD50 orally in Rabbit: 10000 mg/kg |
