Benzophenone , 99% , 119-61-9
Synonym(s):
Benzophenone;Diphenyl ketone;Diphenylketon, Diphenylmethanon, Benzoylbenzol;Diphenylmethanone;NSC 8077
CAS NO.:119-61-9
Empirical Formula: C13H10O
Molecular Weight: 182.22
MDL number: MFCD00003076
EINECS: 204-337-6
| Pack Size | Price | Stock | Quantity |
| 100G | RMB26.40 | In Stock |
|
| 250g | RMB47.20 | In Stock |
|
| 500G | RMB76.00 | In Stock |
|
| 2.5KG | RMB295.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 47-51 °C (lit.) |
| Boiling point: | 305 °C (lit.) |
| Density | 1.11 |
| bulk density | 700kg/m3 |
| vapor density | 4.21 (vs air) |
| vapor pressure | 1 mm Hg ( 108 °C) |
| refractive index | 1.5893 |
| FEMA | 2134 | BENZOPHENONE |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | ethanol: soluble100mg/mL, clear, colorless (80% ethanol) |
| form | Crystalline Powder or Flakes |
| color | White to off-white |
| Odor | Characteristic. |
| biological source | synthetic |
| Odor Type | balsamic |
| Water Solubility | insoluble (<0.1 g/100 mL at 25 ºC) |
| Merck | 14,1098 |
| JECFA Number | 831 |
| BRN | 1238185 |
| Dielectric constant | 13.0(20℃) |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents. Combustible. |
| Cosmetics Ingredients Functions | LIGHT STABILIZER FRAGRANCE |
| InChI | 1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| SMILES | O=C(C1=CC=CC=C1)C2=CC=CC=C2 |
| LogP | 3.18 at 25℃ |
| CAS DataBase Reference | 119-61-9(CAS DataBase Reference) |
| IARC | 2B (Vol. 101) 2013 |
| NIST Chemistry Reference | Benzophenone(119-61-9) |
| EPA Substance Registry System | Benzophenone (119-61-9) |
Description and Uses
Benzophenone is a combustible, white,crystalline solid with a rose-like odor. Molecularweight=182.23; Specific gravity (H2O:1) = 1.085 at 50℃;Boiling point = 305℃; Freezing/Melting point = 48.5℃;Latent heat of vaporization=2.93 3 105 J/kg; Heat ofcombustion= -358 3 105 J/kg. Hazard Identification(based on NFPA-704 M Rating System): Health 1,Flammability 1, Reactivity 0. Insoluble in water.
Benzophenone is used as a synthetic intermediate for manufacture of pharmaceuticals and agricultural chemicals. It is also used as a photoinitiator in UV-curable printing inks, as a fragrance in perfumes, as a flavor enhancer in foods. Benzophenone can be added as a UV-absorbing agent to plastics, lacquers, and coatings at concentrations of 2–8%.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H373-H412 |
| Precautionary statements | P260-P273-P314-P501 |
| target organs | Liver,Kidney |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N,Xn,F |
| Risk Statements | 36/37/38-52/53-50/53-67-65-62-51/53-48/20-11-40 |
| Safety Statements | 26-61-37/39-29-60-36-62-36/37-33-16-9 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DI9950000 |
| F | 10 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29143900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Carc. 1B STOT RE 2 Oral |
| Hazardous Substances Data | 119-61-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: > 10000 mg/kg LD50 dermal Rabbit 3535 mg/kg |






