A0604912
Acetone-d6 , (D,99.96%)(+0.03%V/VTMS) , 666-52-4
Synonym(s):
Acetone-D6;Hexadeuteroacetone
CAS NO.:666-52-4
Empirical Formula: C3D6O
Molecular Weight: 64.12
MDL number: MFCD00044635
EINECS: 211-563-9
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB799.20 | In Stock |
|
| 10×0.6ML | RMB1039.20 | In Stock |
|
| 10×0.75ml | RMB1359.20 | In Stock |
|
| 25ML | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −93.8 °C(lit.) |
| Melting point: | -94°C |
| Boiling point: | 56,5°C |
| Boiling point: | 55.5 °C(lit.) |
| Density | d = 0,87 |
| Density | 0.872 g/mL at 25 °C(lit.) |
| vapor density | 2 (vs air) |
| vapor pressure | 14.39 psi ( 55 °C) |
| refractive index | n |
| Flash point: | 1 °F |
| storage temp. | Store below +30°C. |
| form | Liquid In Prescored Ampoules, (0.75Ml/ampoule) |
| color | Colorless |
| Specific Gravity | 0.872 |
| PH | 5-6 (365g/l, H2O) |
| explosive limit | 2.6-12.8%(V) |
| Water Solubility | Soluble in water. |
| BRN | 1702935 |
| Stability: | Stable. Highly flammable. Readily forms explosive mixtures with air. Note low flashpoint and wide explosion limits. Incompatible with bases, oxidising agents, strong acids, reducing agents. Protect from moisture. |
| InChI | 1S/C3H6O/c1-3(2)4/h1-2H3/i1D3,2D3 |
| InChIKey | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] |
| CAS DataBase Reference | 666-52-4(CAS DataBase Reference) |
| EPA Substance Registry System | Acetone-d6 (666-52-4) |
Description and Uses
Acetone-d6 may be used as a deuterated solvent in the 1H NMR spectral studies of iodine containing radiopaque poly(methacrylate)copolymers. It may also be used as a source of deuterium atoms in the synthesis of labelled sterols.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P233-P240-P241-P242-P305+P351+P338 |
| target organs | Central nervous system |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36-66-67 |
| Safety Statements | 9-16-26-33-23 |
| RIDADR | UN 1090 3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Autoignition Temperature | 465 °C DIN 51794 |
| HS Code | 2845 90 10 |
| HazardClass | 3 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| Toxicity | LD50 orally in Rabbit: 5800 mg/kg LD50 dermal Rabbit 20000 mg/kg |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




