A0605556
ProcymidoneSolutioninAcetonitrile , 100 μg/mlinetonitrile, uncertainty of 3% , 32809-16-8
CAS NO.:32809-16-8
Empirical Formula: C13H11Cl2NO2
Molecular Weight: 284.14
MDL number: MFCD00078740
EINECS: 251-233-1
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB63.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-167°C |
| Boiling point: | 477.9±35.0 °C(Predicted) |
| Density | d25 1.42-1.46 |
| vapor pressure | 1.8 x 10-2 Pa (25 °C) |
| refractive index | 1.6100 (estimate) |
| Flash point: | >100 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Water Solubility | 4.5 mg l-1 (25 °C) |
| pka | -2.67±0.60(Predicted) |
| color | Off-White to Pale Beige |
| BRN | 1539058 |
| Major Application | agriculture environmental |
| InChI | 1S/C13H11Cl2NO2/c1-12-6-13(12,2)11(18)16(10(12)17)9-4-7(14)3-8(15)5-9/h3-5H,6H2,1-2H3 |
| InChIKey | QXJKBPAVAHBARF-UHFFFAOYSA-N |
| SMILES | CC12CC1(C)C(=O)N(C2=O)c3cc(Cl)cc(Cl)c3 |
| CAS DataBase Reference | 32809-16-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Azabicyclo[3.1.0]hexane-2,4-dione, 3-(3,5-dichlorophenyl)-1,5-dimethyl-(32809-16-8) |
| EPA Substance Registry System | Procymidone (32809-16-8) |
Description and Uses
Systemic agricultural fungicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H411-H332-H373-H370-H413-H360 |
| Precautionary statements | P261-P271-P304+P340-P312-P260-P314-P501-P260-P264-P270-P307+P311-P321-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | GZ2150000 |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 in male rats (mg/kg): 6800 orally, >10000 dermally (Jackson); LD50 in male, female rats (g/kg): 7.8, 9.1 orally (Mikami) |






