A0608112
(S)-α-Amino-γ-butyrolactone hydrochloride , 97% , 2185-03-7
Synonym(s):
L -Homoserine lactone hydrochloride;HSI
CAS NO.:2185-03-7
Empirical Formula: C4H8ClNO2
Molecular Weight: 137.56
MDL number: MFCD00058172
EINECS: 218-571-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB33.60 | In Stock |
|
| 1G | RMB68.00 | In Stock |
|
| 5G | RMB204.00 | In Stock |
|
| 25G | RMB764.00 | In Stock |
|
| 100G | RMB3044.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-220 °C (dec.)(lit.) |
| alpha | -25 º (c=0.5, water) |
| refractive index | -26 ° (C=0.2, H2O) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Pale Beige |
| biological source | rabbit |
| optical activity | [α]20/D 27.8°, c = 1 in H2O |
| Water Solubility | soluble |
| BRN | 3562187 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C4H7NO2.ClH/c5-3-1-2-7-4(3)6;/h3H,1-2,5H2;1H/t3-;/s3 |
| InChIKey | XBKCXPRYTLOQKS-DFWYDOINSA-N |
| SMILES | [C@H]1(N)CCOC1=O.Cl |&1:0,r| |
| CAS DataBase Reference | 2185-03-7(CAS DataBase Reference) |
Description and Uses
(S)-α-Amino-γ-butyrolactone hydrochloride can be used:
- As a precursor for the preparation of amino-keto-alcohols and β-amino acids.
- To prepare N-acylhomoserine lactone (AHL) analogs by reacting with substituted 2-chloro-N-phenylacetamide and different halides.
- As a starting material for the synthesis of L-discadenine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




