A7421012
<small>L</small>-(-)-Lactide , ≥98.0% , 4511-42-6
Synonym(s):
L -Lactide
CAS NO.:4511-42-6
Empirical Formula: C6H8O4
Molecular Weight: 144.13
MDL number: MFCD00070594
EINECS: 224-832-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB288.80 | In Stock |
|
| 100G | RMB1037.60 | In Stock |
|
| 500G | RMB4274.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94 °C(lit.) |
| Boiling point: | 255°C |
| Density | 1.186±0.06 g/cm3(Predicted) |
| vapor pressure | 0.311Pa at 25℃ |
| refractive index | 1.4475 |
| storage temp. | 2-8°C |
| solubility | Soluble in chloroform, and methanol. Slightly soluble in benzene. |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D 285°, c = 1 in toluene |
| Water Solubility | 16.7g/L at 20℃ |
| Sensitive | Moisture Sensitive |
| BRN | 82124 |
| Stability: | Hygroscopic |
| InChI | 1S/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | JJTUDXZGHPGLLC-IMJSIDKUSA-N |
| SMILES | C[C@@H]1OC(=O)[C@H](C)OC1=O |
| LogP | 0.4 at 25℃ |
| CAS DataBase Reference | 4511-42-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Dioxane-2,5-dione, 3,6-dimethyl-, (3S,6S)- (4511-42-6) |
Description and Uses
L-lactide (3,6-dimethyl-1,4-dioxane-2,5-dione) is a cyclic lactone that is derived from lactic acid. It has the molecular formula C3H6O2 and is an essential building block for synthesizing polylactic acid (PLA) plastics, which are widely used in the manufacturing industry.
(3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione may be used in the synthesis of optically active terpyridine containing poly(L-lactide)s, polydisperse lactic acid oligomers, bicyclic and tricyclic lactide derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29322090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |




