A0608412
2-Amino-5-chloro-2′-fluorobenzophenone , 98% , 784-38-3
CAS NO.:784-38-3
Empirical Formula: C13H9ClFNO
Molecular Weight: 249.67
MDL number: MFCD00038381
EINECS: 212-316-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 1G | RMB40.80 | In Stock |
|
| 25G | RMB89.60 | In Stock |
|
| 100g | RMB344.00 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C(lit.) |
| Boiling point: | 207C |
| Density | 1.3134 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -1.05±0.10(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C13H9ClFNO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 |
| InChIKey | GTGMXPIQRQSORU-UHFFFAOYSA-N |
| SMILES | C(C1=CC(Cl)=CC=C1N)(C1=CC=CC=C1F)=O |
| CAS DataBase Reference | 784-38-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (2-amino-5-chlorophenyl)(2-fluorophenyl)-(784-38-3) |
Description and Uses
A starting material for the synthesis of diazepam and other benzodiazepines
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




