A0608512
2,6-Dichloro-4-trifluoromethylaniline , 98% , 24279-39-8
CAS NO.:24279-39-8
Empirical Formula: C7H4Cl2F3N
Molecular Weight: 230.01
MDL number: MFCD00052918
EINECS: 416-430-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.80 | In Stock |
|
| 25G | RMB81.60 | In Stock |
|
| 100G | RMB253.60 | In Stock |
|
| 500G | RMB920.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-36 °C(lit.) |
| Boiling point: | 60-62 °C1 mm Hg(lit.) |
| Density | 1.532 g/mL at 25 °C(lit.) |
| Flash point: | 190 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -1.13±0.10(Predicted) |
| Specific Gravity | 1.532 |
| color | White to Orange to Green |
| BRN | 2838819 |
| InChI | InChI=1S/C7H4Cl2F3N/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 |
| InChIKey | ITNMAZSPBLRJLU-UHFFFAOYSA-N |
| SMILES | C1(N)=C(Cl)C=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 24279-39-8(CAS DataBase Reference) |
Description and Uses
2,6-Dichloro-4-(trifluoromethyl)aniline may be employed for the synthesis of 1-[2,6-di-chloro-4-(tri-fluoro-methyl)-phenyl]-5-[(4-nitro-phenyl)-methyl-ene-imino]-1H-pyrazole-3-carbo-nitrile.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H332-H400-H302+H332-H315-H317-H410 |
| Precautionary statements | P280g-P301+P312a-P304+P340-P321-P501a-P273-P280-P501-P261-P264-P270-P271-P272-P301+P312+P330-P302+P352+P333+P313+P363-P304+P340+P312-P391 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N,T |
| Risk Statements | 20/22-38-43-50/53 |
| Safety Statements | 24-37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |






