A0609512
5-Acetyl-2-amino-4-methylthiazole , 98% , 30748-47-1
CAS NO.:30748-47-1
Empirical Formula: C6H8N2OS
Molecular Weight: 156.21
MDL number: MFCD00051952
EINECS: 626-871-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB96.80 | In Stock |
|
| 25G | RMB372.00 | In Stock |
|
| 100g | RMB1319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 268-272 °C (dec.) (lit.) |
| Boiling point: | 312.8±22.0 °C(Predicted) |
| Density | 1.278±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 3.58±0.10(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | Insoluble |
| BRN | 127111 |
| InChI | InChI=1S/C6H8N2OS/c1-3-5(4(2)9)10-6(7)8-3/h1-2H3,(H2,7,8) |
| InChIKey | PKUKCASRNJIQNU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1SC(N)=NC=1C)C |
| CAS DataBase Reference | 30748-47-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 36/37/39-26-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




