A0610056
Dansylchloride[5-Dimethylaminonaphthalene-1-sulfonylchloride]
Synonym(s):
5-(Dimethylamino)naphthalene-1-sulfonyl chloride;DNSCl;5-(Dimethylamino)-napthalene-1-sulfonyl Chloride;DNS Chloride;1-Dimethylaminonaphthalene-5-sulfonyl chloride
CAS NO.:
Empirical Formula: C12H12ClNO2S
Molecular Weight: 269.75
MDL number: MFCD00003985
EINECS: 210-092-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB509.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-74 °C(lit.) |
| Boiling point: | 371.3±22.0 °C(Predicted) |
| Density | 1.1702 (rough estimate) |
| refractive index | 1.5630 (estimate) |
| storage temp. | 2-8°C |
| solubility | acetone: 50 mg/mL |
| form | powder and chunks |
| pka | 2.38±0.40(Predicted) |
| color | yellow to orange |
| Appearance | Yellow solid |
| Water Solubility | Soluble in dimethyl fluoride, acetone, chloroform, pyridine, benzene and dioxane. Insoluble in water. |
| Sensitive | Moisture Sensitive |
| Merck | 14,2814 |
| BRN | 2217205 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | 1S/C12H12ClNO2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3 |
| InChIKey | XPDXVDYUQZHFPV-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(cccc12)S(Cl)(=O)=O |
| CAS DataBase Reference | 605-65-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenesulfonyl chloride, 5-(dimethylamino)- (605-65-2) |
Description and Uses
Dansyl Chloride is used for fluorescent labelling of amines, amino acids and proteins.
A fluorogenic reagent for N-terminal derivatization of amino acids and peptides and detection by reverse phase HPLC.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P305+P351+P338+P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-3 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | QK3688000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214980 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Met. Corr. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |

![Dansylchloride[5-Dimethylaminonaphthalene-1-sulfonylchloride]](https://img.chemicalbook.com/CAS/GIF/605-65-2.gif)


