A0611112
2,2′-Azobis(2-methylbutyronitrile) , 98% , 13472-08-7
CAS NO.：13472-08-7
Empirical Formula: C10H16N4
Molecular Weight: 192.26
MDL number: MFCD00080408
EINECS: 236-740-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-52 °C |
| Boiling point: | 318.25°C (rough estimate) |
| Density | 1.1 |
| vapor pressure | 0.354Pa at 25℃ |
| refractive index | 1.4910 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 392mg/L at 20℃ |
| Stability: | Explosive. Risk of explosion if struck, ground or heated. Highly flammable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C10H16N4/c1-5-9(3,7-11)13-14-10(4,6-2)8-12/h5-6H2,1-4H3 |
| InChIKey | AVTLBBWTUPQRAY-UHFFFAOYSA-N |
| SMILES | N(C(C)(CC)C#N)=NC(C)(CC)C#N |
| LogP | 2.07 at 20℃ |
| CAS DataBase Reference | 13472-08-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2,2'-Azobis[2-methylbutanenitrile] (13472-08-7) |
Safety
| Symbol(GHS) |   GHS07,GHS02 |
| Signal word | Danger |
| Hazard statements | H242-H302 |
| Precautionary statements | P210-P220-P234-P280-P370+P378-P403+P235-P411-P420-P501-P264-P270-P301+P312-P330-P501 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-22-2017/11/22 |
| Safety Statements | 47-36/37/39-24/25-16 |
| RIDADR | UN 3236 4.1 |
| WGK Germany | 1 |
| RTECS | EK4818750 |
| F | 4.4 |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29270000 |
| Toxicity | LD50 orl-rat: 982 mg/kg NTIS** OTS0540633 |
