A0629312
2,2'-Azobis(2-methylpropionitrile) , 99%, heavy crystals , 78-67-1
Synonym(s):
AIBN;Azobisisobutyronitrile;Free radical initiator;radical initiator;AIBN solution
CAS NO.:78-67-1
Empirical Formula: C8H12N4
Molecular Weight: 164.21
MDL number: MFCD00013808
EINECS: 201-132-3
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-104 °C (dec.)(lit.) |
| Boiling point: | 281.68°C (rough estimate) |
| Density | 1.11 |
| vapor pressure | 0.81Pa at 24.85℃ |
| refractive index | n20/D1.495 |
| Flash point: | 4℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Crystals from EtOH |
| Odor | odorless |
| Water Solubility | Insoluble |
| Merck | 13,920 |
| BRN | 1708400 |
| Stability: | Stability Flammable solid. Shock sensitive. Thermally unstable. May be explosive in combination with acetone or heptane. Incompatible with oxidizing agents. |
| InChI | 1S/C8H12N4/c1-7(2,5-9)11-12-8(3,4)6-10/h1-4H3/b12-11+ |
| InChIKey | OZAIFHULBGXAKX-VAWYXSNFSA-N |
| SMILES | CC(C)(\N=N\C(C)(C)C#N)C#N |
| LogP | 1.1 at 25℃ |
| CAS DataBase Reference | 78-67-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,2'-Azo-bis-isobutyronitrile(78-67-1) |
| EPA Substance Registry System | Azobis(isobutyronitrile) (78-67-1) |
Description and Uses
Azobisisobutylonitrile (AIBN) is a white crystallinecompound. Molecular weight= 164.21; Specific gravity(H2O:1)= 1.11 at 25℃; Boiling point= decomposes;Freezing/Melting point= 99°103℃ (decomposes);Autoignition temperature= 63℃. NFPA 704 M HazardIdentification (based on NFPA-704M Rating System):Health 3, Flammability 2, Reactivity 2. Insoluble in water.
foaming agent and inhibitor in plastic and elastomer materials
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H242-H302+H332-H412 |
| Precautionary statements | P210-P235-P273-P304+P340+P312-P370+P378-P403 |
| target organs | Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | E,Xn,F,Xi |
| Risk Statements | 2-11-20/22-52/53-67-65-48/20-38-63-66-36 |
| Safety Statements | 39-41-47-61-62-36/37-16-26 |
| RIDADR | UN 3234 4.1 |
| WGK Germany | 2 |
| RTECS | UG0800000 |
| F | 4.4 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29269090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Asp. Tox. 1 Flam. Liq. 2 Repr. 2 Skin Irrit. 2 STOT RE 2 STOT SE 3 |
| Hazardous Substances Data | 78-67-1(Hazardous Substances Data) |
| Toxicity | LDLo orl-rat: 670 mg/kg 34ZIAG 0,117,69 |
| Excepted Quantities | Forbidden |








