A1100012
2,2'-Azobis(2,4-dimethyl)valeronitrile , 98% , 4419-11-8
CAS NO.:4419-11-8
Empirical Formula: C14H24N4
Molecular Weight: 248.37
MDL number: MFCD00081059
EINECS: 224-583-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-70°C |
| Boiling point: | 330.6±27.0 °C(Predicted) |
| Density | 0.93±0.1 g/cm3(Predicted) |
| vapor pressure | 0.812Pa at 20℃ |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 9.37mg/L at 20℃ |
| InChI | InChI=1S/C14H24N4/c1-11(2)7-13(5,9-15)17-18-14(6,10-16)8-12(3)4/h11-12H,7-8H2,1-6H3 |
| InChIKey | WYGWHHGCAGTUCH-UHFFFAOYSA-N |
| SMILES | N(C(C)(CC(C)C)C#N)=NC(C)(CC(C)C)C#N |
| LogP | 3.37 at 25℃ |
| CAS DataBase Reference | 4419-11-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2,2'-Azobis[2,4-dimethylpentanenitrile] (4419-11-8) |
Description and Uses
2,2'-azobis(2,4-dimethyl)valeronitrile is widely used in PVC suspension polymerization, it is also used as polyacrylonitrile, polyvinyl alcohol polymer composite materials such as plexiglass efficient initiator, also used as rubber, plastic foam.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Risk Statements | 2017/11/22 |
| Safety Statements | 16-22-24/25-36/37/39-45 |
| RIDADR | UN 2953 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29270000 |






