A0613112
trans-(1R,2R)-2-Aminocyclopentanol Hydrochloride , 97% , 68327-11-7
CAS NO.:68327-11-7
Empirical Formula: C5H12ClNO
Molecular Weight: 137.61
MDL number: MFCD09834692
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB72.00 | In Stock |
|
| 5G | RMB285.60 | In Stock |
|
| 25g | RMB1063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-196 °C(lit.) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 4143621 |
| InChI | InChI=1/C5H11NO.ClH/c6-4-2-1-3-5(4)7;/h4-5,7H,1-3,6H2;1H/t4-,5-;/s3 |
| InChIKey | ZFSXKSSWYSZPGQ-TXRIQCMBNA-N |
| SMILES | [C@@H]1(O)CCC[C@H]1N.[H]Cl |&1:0,5,r| |
| CAS DataBase Reference | 68327-11-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H302-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |




![rel-(1R,5S,6s)-tert-Butyl 6-amino-3-azabicyclo[3.1.0]hexane-3-carboxylate](https://img.chemicalbook.com/CAS/GIF/273206-92-1.gif)


