A0613412
4-Amino-4'-nitrodiphenyl Sulfide , 98% , 101-59-7
Synonym(s):
4-(4-Nitrophenylthio)aniline
CAS NO.:101-59-7
Empirical Formula: C12H10N2O2S
Molecular Weight: 246.29
MDL number: MFCD00007881
EINECS: 202-957-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB56.00 | In Stock |
|
| 5G | RMB177.60 | In Stock |
|
| 25G | RMB714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-145 °C(lit.) |
| Boiling point: | 479.1±30.0 °C(Predicted) |
| Density | 1.3031 (rough estimate) |
| refractive index | 1.5950 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.99±0.10(Predicted) |
| color | Orange prisms with blue reflex from C6H6, crystfrom EtOH |
| InChI | 1S/C12H10N2O2S/c13-9-1-5-11(6-2-9)17-12-7-3-10(4-8-12)14(15)16/h1-8H,13H2 |
| InChIKey | ZBPKGHOGUVVDLF-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Sc2ccc(cc2)[N+]([O-])=O)cc1 |
| CAS DataBase Reference | 101-59-7(CAS DataBase Reference) |
| EPA Substance Registry System | 4-[(4-Nitrophenyl)thio]aniline (101-59-7) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | WP9640000 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mmo-sat 25 mg/plate MUREAV 67,123,79 |






