A0613612
4-Aminophenyl disulfide , 98% , 722-27-0
Synonym(s):
4,4′-Dithiodianiline
CAS NO.:722-27-0
Empirical Formula: C12H12N2S2
Molecular Weight: 248.37
MDL number: MFCD00007882
EINECS: 211-961-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-78 °C(lit.) |
| Boiling point: | 447.0±30.0 °C(Predicted) |
| Density | 1.2716 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.10±0.10(Predicted) |
| color | White to Yellow to Green |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. Sensitive to air. |
| InChI | InChI=1S/C12H12N2S2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H,13-14H2 |
| InChIKey | MERLDGDYUMSLAY-UHFFFAOYSA-N |
| SMILES | S(C1=CC=C(N)C=C1)SC1=CC=C(N)C=C1 |
| CAS DataBase Reference | 722-27-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,4'-Dithiodianiline(722-27-0) |
| EPA Substance Registry System | 4,4'-Dithiodianiline (722-27-0) |
Description and Uses
4-Aminophenyl disulfide can be used as:
- A crosslinker in the synthesis of self-healing poly(urea-urethane) elastomers because of its quantitative healing efficiency. These self-healing materials find applications in various fields such as drug delivery, wound healing, and tissue engineering, electronics, aerospace, and coatings.
- A hardener in the formulation of re-processable, repairable, and recyclable epoxy networks due to the presence of dynamic disulfide bonds, which enable the epoxy networks to undergo chemical recycling. These epoxy networks are widely used in various applications which include, composite materials, coatings, adhesives, and fiber-reinforced thermoset composites.
- A crosslinking agent for the development of epoxy vitrimers and carbon fiber composites with enhanced mechanical properties, multi-shape memory capabilities for the potential applications in high-performance materials.
Bioconjugation: The amine group can react with carboxylic acids or their derivatives, making it useful for conjugating biomolecules like proteins and peptides. This is particularly valuable in developing targeted drug delivery systems where the drug is directly linked to a molecule th at can home in on cancer cells or other disease sites.
Diagnostic Agents: It can be used to modify surfaces of diagnostic devices, such as biosensors. They can help in the immobilization of biomolecules on sensor surfaces, improving the sensitivity and specificity of detection.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BX9580000 |
| TSCA | TSCA listed |
| HS Code | 29309090 |
| Toxicity | mma-sat 100 mg/plate MUREAV 67,123,79 |




