Anisomycin from Streptomyces griseolus , 97% , 22862-76-6
Synonym(s):
(2R,3S,4S)-2-(4-Methoxybenzyl)-3,4-pyrrolidinediol-3-acetate;2-( p-Methoxybenzyl)-3,4-pyrrolidinediol-3-acetate;2-(p-Methoxybenzyl)-3,4-pyrrolidinediol-3-acetate;2-[(4-Methoxyphenyl)methyl]-3,4-pyrrolidinediol 3-acetate;Flagecidin
CAS NO.:22862-76-6
Empirical Formula: C14H19NO4
Molecular Weight: 265.3
MDL number: MFCD00077650
EINECS: 245-269-7
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB134.40 | In Stock |
|
| 25MG | RMB340.00 | In Stock |
|
| 100MG | RMB956.80 | In Stock |
|
| 500mg | RMB3503.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 140-141 C |
| Boiling point: | 408.52°C (rough estimate) |
| alpha | D23 -30° (methanol) |
| Density | 1.1356 (rough estimate) |
| refractive index | 1.5230 (estimate) |
| Flash point: | 87℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | methanol: 20 mg/mL, clear, colorless to faintly yellow |
| pka | 7.9(at 25℃) |
| form | solid |
| color | white |
| Water Solubility | Soluble in water at 2 mg/ml, in DMSO at 20mg/ml, and in methanol at 20mg/ml |
| λmax | 283nm(EtOH)(lit.) |
| Merck | 14,670 |
| BRN | 20705 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H19NO4/c1-9(16)19-14-12(15-8-13(14)17)7-10-3-5-11(18-2)6-4-10/h3-6,12-15,17H,7-8H2,1-2H3/t12-,13+,14+/m1/s1 |
| InChIKey | YKJYKKNCCRKFSL-RDBSUJKOSA-N |
| SMILES | COc1ccc(C[C@H]2NC[C@H](O)[C@H]2OC(C)=O)cc1 |
Description and Uses
Anisomycin (22862-76-6) activates JNK/SAPKs and reduces c-fos and c-jun. Protein synthesis inhibitor. Anisomycin induces apoptosis and sensitizes cells to anoikis. Cell permeable.
It is applied as an antiparasitic agent and antineoplastic agent. It acts as a protein synthesis inhibitor (blocks translation), potent activator of stress-activated protein kinases (JNK/SAPK) and p38 MAP kinase. It also scts as a potent signaling agonist to selectively elicit homologous desensitization of immediate early gene induction (c-fos, fosB, c-jun, junB and junD). Activates mitogen-activated protein (MAP) kinases (JNK/SAPK and p38/RK).
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn |
| Risk Statements | 25-36/37/38-20/21/22 |
| Safety Statements | 45-36-26 |
| RIDADR | UN 3462 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BZ9800000 |
| F | 3-10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29419090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 orl-rat: 72 mg/kg ANTCAO 5,490,55 |





