A0617612
2-Amino-5-methylbenzoic acid , 97% , 2941-78-8
Synonym(s):
5-Methylanthranilic acid
CAS NO.:2941-78-8
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00007909
EINECS: 220-932-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB108.00 | In Stock |
|
| 500G | RMB493.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175 °C (dec.) (lit.) |
| Boiling point: | 273.17°C (rough estimate) |
| Density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.27±0.10(Predicted) |
| form | Powder |
| color | Off-white to beige |
| BRN | 1101527 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H9NO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | NBUUUJWWOARGNW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C)=CC=C1N |
| CAS DataBase Reference | 2941-78-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-5-methylbenzoic acid(2941-78-8) |
Description and Uses
2-Amino-5-methylbenzoic acid can be used to synthesize quinazolinedione.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





