PRODUCT Properties
| Melting point: | 128-129 °C (lit.) |
| Boiling point: | 307.46°C (rough estimate) |
| Density | 1.0459 (rough estimate) |
| refractive index | 1.5361 (estimate) |
| Flash point: | 217 °C |
| storage temp. | Store at room temperature |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | 1 g/L (20 ºC) |
| BRN | 1871711 |
| InChI | InChI=1S/C15H12O/c1-10(16)11-6-7-15-13(8-11)9-12-4-2-3-5-14(12)15/h2-8H,9H2,1H3 |
| InChIKey | IBASEVZORZFIIH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1C=CC2C3=C(CC=2C=1)C=CC=C3)C |
| CAS DataBase Reference | 781-73-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Acetylfluorene(781-73-7) |
Description and Uses
2-Acetylfluorene is a crystalline powder of light yellow and is stable under normal temperatures and pressures. 2-Acetylfluorene is incompatible with strong oxidising agents. 2-Acetylfluorene on decomposition releases carbon monoxide and carbon dioxide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | OB3800000 |
| HS Code | 29143990 |
