M3362835
Kresoxim-methyl , 97% , 143390-89-0
Synonym(s):
Kresoxim-methyl;Methyl (E)-α-(methoxyimino)-2-(2-methylphenoxymethyl)phenylacetate
CAS NO.:143390-89-0
Empirical Formula: C18H19NO4
Molecular Weight: 313.35
MDL number: MFCD00871777
EINECS: 604-351-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5g | RMB97.60 | In Stock |
|
| 25g | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100°C |
| Boiling point: | 429.4±47.0 °C(Predicted) |
| Density | 1.28 |
| vapor pressure | 2.3 x 10-6 P a (20 °C) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform: Slightly Soluble,Methanol: Slightly Soluble |
| form | Liquid |
| Water Solubility | 2 mg l-1(20 °C) |
| Specific Gravity | 1.28 (20℃) |
| color | Colorless to light yellow |
| BRN | 8330581 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C18H19NO4/c1-13-8-4-7-11-16(13)23-12-14-9-5-6-10-15(14)17(19-22-3)18(20)21-2/h4-11H,12H2,1-3H3/b19-17+ |
| InChIKey | ZOTBXTZVPHCKPN-HTXNQAPBSA-N |
| SMILES | CO\N=C(\C(=O)OC)c1ccccc1COc2ccccc2C |
| LogP | 3.44 at 25℃ |
| Surface tension | 72.8mN/m at 1.8mg/L and 20℃ |
| CAS DataBase Reference | 143390-89-0(CAS DataBase Reference) |
| EPA Substance Registry System | Kresoxim-methyl (143390-89-0) |
Description and Uses
Kresoxim-methyl is a strobilurin fungicide. It inhibits conidial germination of V. inaequalis isolates from apple orchards (EC50s = 0.00033-0.0078 mg/L). Kresoxim-methyl also inhibits mycelial growth (EC50 = 0.240 mg/L) and is fungicidal against Saprolegnia (MIC = 1 mg/L). It increases intracellular calcium levels and disrupts the mitochondrial membrane potential in mouse cortical cultures in a concentration-dependent manner. Kresoxim-methyl is toxic to goldfish (C. auratus; LC50 = 0.807 mg/L).
Agricultural fungicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 40-50/53 |
| Safety Statements | 2-36/37-60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
| Hazardous Substances Data | 143390-89-0(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally (Ammerman) |





