A5419312
Metsulfuron-methyl solution , analyticalstandard,100ug/mlinacetone , 74223-64-6
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB73.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158°C |
| Boiling point: | 181°C (rough estimate) |
| Density | 1.4561 (rough estimate) |
| refractive index | 1.6460 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 2.55±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | 27mg/L(temperature not stated) |
| BRN | 587472 |
| Henry's Law Constant | 7.5×1010 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C14H15N5O6S/c1-8-15-12(18-14(16-8)25-3)17-13(21)19-26(22,23)10-7-5-4-6-9(10)11(20)24-2/h4-7H,1-3H3,(H2,15,16,17,18,19,21) |
| InChIKey | RSMUVYRMZCOLBH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1S(NC(NC1=NC(OC)=NC(C)=N1)=O)(=O)=O |
| LogP | 2.200 |
| CAS DataBase Reference | 74223-64-6(CAS DataBase Reference) |
| EPA Substance Registry System | Metsulfuron-methyl (74223-64-6) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DH3563000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 74223-64-6(Hazardous Substances Data) |
| Toxicity | LD50 in male and female rats, in male and female rabbits (mg/kg): >5000, >2000 orally; LC50 (96 hour) in American perch, rainbow trout: 150 ppm; LD50 in wild ducks: 2510 mg/kg (Lefebvre) |




