A0620012
2-Amino-6-methyl-3-nitropyridine , 98% , 21901-29-1
Synonym(s):
6-Amino-5-nitro-2-picoline;6-Methyl-3-nitro-2-pyridinamine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 25G | RMB413.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-157 °C |
| Boiling point: | 276.04°C (rough estimate) |
| Density | 1.3682 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.50±0.50(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | 1S/C6H7N3O2/c1-4-2-3-5(9(10)11)6(7)8-4/h2-3H,1H3,(H2,7,8) |
| InChIKey | LCJXSRQGDONHRK-UHFFFAOYSA-N |
| SMILES | CC1=NC(N)=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 21901-29-1(CAS DataBase Reference) |
Description and Uses
2-Amino-6-methyl-3-nitropyridine used as a intermediate in organic synthesis and used in medicine.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H334-H318-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P342+P311 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 |








