A1243912
2-Bromo-5-nitropyridine , 98% , 4487-59-6
CAS NO.:4487-59-6
Empirical Formula: C5H3BrN2O2
Molecular Weight: 202.99
MDL number: MFCD00006222
EINECS: 224-777-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 100G | RMB530.40 | In Stock |
|
| 500g | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-141 °C (lit.) |
| Boiling point: | 145-147 °C/10 mmHg (lit.) |
| Density | 1.8727 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| Flash point: | 145-147°C/10mm |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Hot Methanol |
| form | Crystalline Powder |
| pka | -3.24±0.10(Predicted) |
| color | Light yellow to light brown |
| Water Solubility | Insoluble in water. |
| BRN | 120901 |
| InChI | InChI=1S/C5H3BrN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H |
| InChIKey | HUUFTVUBFFESEN-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 4487-59-6(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-nitropyridine was used in preparation of boc-protected (piperazin-1-ylmethyl)biaryls via microwave-mediated Suzuki-Miyaura coupling with (boc-piperazin-1-ylmethyl)phenylboronic acid pinacol esters. It was also used in the synthesis of 2-pyridyl analogs. Substituted 5-nitro-2-ethynylpyridines were synthesized by the Sonogashira reaction of 2-bromo-5-5-nitropyridine with terminal acetylenes.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-37/39-22-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




