A1317612
3-Bromonitrobenzene , 98% , 585-79-5
Synonym(s):
3-Bromo-1-nitrobenzene;3-Nitro-1-bromobenzene
CAS NO.：585-79-5
Empirical Formula: C6H4BrNO2
Molecular Weight: 202.01
MDL number: MFCD00024298
EINECS: 209-563-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-54 °C |
| Boiling point: | 256 °C |
| Density | 1.704 |
| refractive index | 1.6050 (estimate) |
| Flash point: | 113 °C |
| storage temp. | Refrigerator |
| solubility | 10g/l |
| form | Solid |
| color | Off-White to Pale Yellow |
| BRN | 2043212 |
| InChI | InChI=1S/C6H4BrNO2/c7-5-2-1-3-6(4-5)8(9)10/h1-4H |
| InChIKey | FWIROFMBWVMWLB-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 585-79-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-3-nitro-(585-79-5) |
| EPA Substance Registry System | Benzene, 1-bromo-3-nitro- (585-79-5) |
Description and Uses
Labelled glycerol kinase substrate specificity
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 36/37/38-20/21/22-33-23/24/25 |
| Safety Statements | 36/37/39-26-22-45-37-28A-28-37/39 |
| RIDADR | 2732 |
| WGK Germany | 3 |
| RTECS | CY9040500 |
| Hazard Note | Harmful |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29049090 |
