A6194512
4-Nitrobenzoic acid , Melting point standard , 62-23-7
Synonym(s):
4-Nitrobenzoic acid;Benzocaine impurity E (PhEur)
CAS NO.:62-23-7
Empirical Formula: C7H5NO4
Molecular Weight: 167.12
MDL number: MFCD00007352
EINECS: 200-526-2
| Pack Size | Price | Stock | Quantity |
| 2G | RMB455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237-240 °C(lit.) |
| Boiling point: | 295.67°C (rough estimate) |
| bulk density | 700kg/m3 |
| Density | 1.61 |
| refractive index | 1.6280 (estimate) |
| Flash point: | 237 °C |
| storage temp. | Store below +30°C. |
| solubility | 0.42g/l |
| form | Crystalline Powder |
| pka | 3.41(at 25℃) |
| color | Light yellow |
| PH | 3.1 (0.42g/l, H2O, 20℃)(saturated solution) |
| Water Solubility | <0.1 g/100 mL at 26 ºC |
| Merck | 14,6589 |
| BRN | 973593 |
| Specific Activity | 50-60 mCi/mmol |
| Concentration | 0.1 mCi/ml |
| Solvent | Ethanol |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, cyanides, strong bases. |
| InChI | 1S/C7H5NO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | OTLNPYWUJOZPPA-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(cc1)[N+]([O-])=O |
| LogP | 1.890 |
| CAS DataBase Reference | 62-23-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-nitro-(62-23-7) |
| EPA Substance Registry System | p-Nitrobenzoic acid (62-23-7) |
Description and Uses
4-Nitrobenzoic Acid is used in the synthesis of anti-Trypanosoma cruzi agents in the treatment of chagas disease.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H341-H351-H361fd |
| Precautionary statements | P202-P264-P301+P312-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-41-36 |
| Safety Statements | 26-39-24/25 |
| WGK Germany | 1 |
| RTECS | DH5075000 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Muta. 2 Repr. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 62-23-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 1960 mg/kg |







