A6154812
p-Nitrobenzaldehyde , AR,>97.0%(GC) , 555-16-8
Synonym(s):
4-Nitrobenzaldehyde
CAS NO.:555-16-8
Empirical Formula: C7H5NO3
Molecular Weight: 151.12
MDL number: MFCD00007346
EINECS: 209-084-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB131.20 | In Stock |
|
| 250g | RMB239.20 | In Stock |
|
| 500G | RMB404.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-106 °C(lit.) |
| Boiling point: | 273.1°C (rough estimate) |
| bulk density | 400kg/m3 |
| Density | 1,496 g/cm3 |
| refractive index | 1.5800 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | 2.34g/l |
| form | Crystalline Powder |
| color | Yellow to brown |
| Odor | Odorless |
| Water Solubility | Soluble in water, ethanol, benzene, glacial acetic acid. Slightly soluble in ether. |
| Sensitive | Air Sensitive |
| Merck | 14,6587 |
| BRN | 386796 |
| InChI | 1S/C7H5NO3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H |
| InChIKey | BXRFQSNOROATLV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(C=O)cc1 |
| CAS DataBase Reference | 555-16-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzaldehyde, 4-nitro-(555-16-8) |
| EPA Substance Registry System | Benzaldehyde, 4-nitro- (555-16-8) |
Description and Uses
4-Nitrobenzaldehyde was used in the preparation of homoallylic alcohols. It was also used to develop and evaluate a series of tripeptide organocatalysts.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36-43-52/53-36/37/38-68 |
| Safety Statements | 26-36/37-61-24/25-36/37/39-36 |
| WGK Germany | 2 |
| RTECS | CU7350000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| Toxicity | LD50 orally in Rabbit: 4700 mg/kg LD50 dermal Rat 16000 mg/kg |




