A6164912
4-Nitrobenzonitrile , 97% , 619-72-7
CAS NO.:619-72-7
Empirical Formula: C7H4N2O2
Molecular Weight: 148.12
MDL number: MFCD00007279
EINECS: 210-610-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB48.00 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100G | RMB766.40 | In Stock |
|
| 250G | RMB1079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-147 °C(lit.) |
| Boiling point: | 268.69°C (rough estimate) |
| Density | 1.4015 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 1.65g/l slightly soluble |
| form | Fine Crystalline Powder |
| color | Yellow |
| BRN | 972078 |
| InChI | InChI=1S/C7H4N2O2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H |
| InChIKey | NKJIFDNZPGLLSH-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 619-72-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 4-nitro-(619-72-7) |
| EPA Substance Registry System | Benzonitrile, 4-nitro- (619-72-7) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H311+H331 |
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352+P312-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 36/37/39-45-28A-36/37-22-26 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DI4903500 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29269095 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Acute Tox. 3 Dermal Acute Tox. 3 Inhalation |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |




