A0620612
Acriflavine(Neutral) , Cl,13.3-15.8% , 8048-52-0
Synonym(s):
3,6-Diamino-10-methylacridinium chloride mixt. with 3,6-diaminoacridine (proflavine);Euflavine;Trypaflavine Neutral
CAS NO.：8048-52-0
Empirical Formula: C27H25ClN6
Molecular Weight: 468.98
MDL number: MFCD00064307
EINECS: 999-999-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB83.20 | In Stock |
|
| 25G | RMB391.20 | In Stock |
|
| 100G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-181 °C |
| Boiling point: | 612.69°C (rough estimate) |
| Density | 1.0933 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store at -20°C |
| solubility | H2O: soluble0.33g/mL (lit.)(lit.) |
| form | Powder |
| color | Deep orange to brownish-red |
| Water Solubility | H2O: 0.33g/mL (lit.)(lit.) |
| Merck | 14,123 |
| InChIKey | PEJLNXHANOHNSU-UHFFFAOYSA-N |
| SMILES | C12C=C(N)C=CC1=CC1=CC=C(N)C=C1[N+]=2C.C12C=C(C=CC1=CC1=CC=C(N)C=C1N=2)N.[Cl-] |
| CAS DataBase Reference | 8048-52-0(CAS DataBase Reference) |
| EPA Substance Registry System | Xanthacridinum (8048-52-0) |
Description and Uses
Acriflavine is used in applications for dual fluorescence analysis of cellular DNA and protein simultaneously.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-37/38-41-50/53-20/21/22-50-36/37/38 |
| Safety Statements | 26-39-60-61-36-37/39-29-36/37/39 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | AR9660000 |
| HS Code | 38249064 |
