A6168812
Neutral red , ACS , 553-24-2
Synonym(s):
3-Amino-7-dimethylamino-2-methylphenazine hydrochloride;Basic Red 5;Neutral Red;Neutral Red solution;Toluylene red
CAS NO.:553-24-2
Empirical Formula: C15H17ClN4
Molecular Weight: 288.78
MDL number: MFCD00012651
EINECS: 209-035-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB190.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290 °C (dec.) (lit.) |
| Boiling point: | 441.31°C (rough estimate) |
| Density | 1.1590 (rough estimate) |
| bulk density | 350-500kg/m3 |
| refractive index | 1.6110 (estimate) |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: soluble10mg/mL |
| form | Solid |
| Colour Index | 50040 |
| pka | 6.7, 7.4(at 25℃) |
| color | Very dark green |
| PH Range | 6.8(red)-8(yellow) |
| PH | 3.1 (10g/l, H2O, 20℃) |
| Odor | Odorless |
| Appearance | Solid Powder |
| Water Solubility | 50 g/L |
| λmax | 540nm, 533nm, 544nm, 529nm, 454nm |
| Merck | 14,6488 |
| BRN | 3918740 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Biological Applications | Detecting pathogens,bacterial infections; treating age-related macular degeneration,burns,cancer,diabetes,obesity,fungal infections,viral diseases |
| Major Application | Fuel cell power generation system, liquid crystal displays, solor cells, sensors, thermochromic materials, coloring wood, detergents, assessment of tobacco smoke, cosmetics, detect bacterial infections, multidrug resistance inhibitors, treatment of burns, endodontic, diabetes, obesity, cancer, age-related macular degeneration, viral diseases |
| InChI | 1S/C15H16N4.ClH/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13;/h4-8H,16H2,1-3H3;1H |
| InChIKey | PGSADBUBUOPOJS-UHFFFAOYSA-N |
| SMILES | Cl.CN(C)c1ccc2nc3cc(C)c(N)cc3nc2c1 |
| CAS DataBase Reference | 553-24-2(CAS DataBase Reference) |
| EPA Substance Registry System | Neutral Red (553-24-2) |
Description and Uses
Neutral red is useful as a biological stain and as an indicator for preparing neutral red paper.
Can be used as a vital stain, to stain living cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 68-36/37/38 |
| Safety Statements | 36/37-37/39-36-26-24/25 |
| WGK Germany | 3 |
| RTECS | SG1400000 |
| TSCA | TSCA listed |
| HS Code | 32041300 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 intraperitoneal in mouse: 432mg/kg |






