A0621712
D-Arginine monohydrochloride , 98% , 627-75-8
CAS NO.：627-75-8
Empirical Formula: C6H15ClN4O2
Molecular Weight: 210.66
MDL number: MFCD00012620
EINECS: 211-010-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100g | RMB487.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-218 °C(lit.) |
| alpha | -21 º (c=3.5 1 N HCl) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | white |
| Water Solubility | Soluble in water (50 mg/ml), and 3N HCl (5). |
| BRN | 5773432 |
| InChI | InChI=1/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/s3 |
| InChIKey | KWTQSFXGGICVPE-PGMHMLKASA-N |
| SMILES | C([C@@H](N)C(=O)O)CCNC(=N)N.Cl |&1:1,r| |
| LogP | -1.287 (est) |
| CAS DataBase Reference | 627-75-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Arginine hydrochloride(L)(627-75-8) |
| EPA Substance Registry System | D-Arginine, monohydrochloride (627-75-8) |
Description and Uses
The influence in creatinine metabolismis that by that d-arginine monohydrochloride caused slightly larger increases in muscle creatine. D-Arginyl ethyl ester was synthesized by vigorously stirring D-arginine monohydrochloride and excess anhydrous ethanol in an ice bath.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| Risk Statements | 20/22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | CF1995000 |
| TSCA | Yes |
| HS Code | 29252900 |
| Toxicity | LD50 ipr-rat: 3582 mg/kg ABBIA4 64,319,56 |
