A7683612
D-Tryptophanol , 97% , 52485-52-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB125.60 | In Stock |
|
| 1G | RMB324.00 | In Stock |
|
| 5G | RMB964.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89 °C (lit.) |
| alpha | -20.5 º (c=1 in methanol) |
| Boiling point: | 444.2±30.0 °C(Predicted) |
| Density | 1.245±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 12.85±0.10(Predicted) |
| Appearance | Light yellow to brown Solid |
| optical activity | [α]20/D +18.5°, c = 1 in methanol |
| Major Application | peptide synthesis |
| InChI | InChI=1/C11H14N2O/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11/h1-4,6,9,13-14H,5,7,12H2/t9-/s3 |
| InChIKey | UDQCRUSSQAXPJY-DJEYLCQNNA-N |
| SMILES | C12C=CC=CC=1NC=C2C[C@@H](N)CO |&1:10,r| |
| CAS DataBase Reference | 52485-52-6(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P301+P330+P331-P312-P280-P302+P352-P304+P340 |
| Hazard Codes | Xi |
| Risk Statements | 22-36/37/38-37/38-41 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |







