A0632750
Diethylaminomalonatehydrochloride , 98% , 13433-00-6
Synonym(s):
Aminomalonic acid diethyl ester hydrochloride
CAS NO.:13433-00-6
Empirical Formula: C7H14ClNO4
Molecular Weight: 211.64
MDL number: MFCD00012510
EINECS: 236-556-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB26.40 | In Stock |
|
| 25g | RMB52.00 | In Stock |
|
| 100g | RMB124.00 | In Stock |
|
| 500g | RMB541.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-170 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, DMSO, Water |
| form | Crystalline Powder |
| color | White to slightly yellow |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 3568037 |
| InChI | InChI=1S/C7H13NO4.ClH/c1-3-11-6(9)5(8)7(10)12-4-2;/h5H,3-4,8H2,1-2H3;1H |
| InChIKey | GLFVNTDRBTZJIY-UHFFFAOYSA-N |
| SMILES | C(N)(C(=O)OCC)C(=O)OCC.Cl |
| CAS DataBase Reference | 13433-00-6(CAS DataBase Reference) |
Description and Uses
Diethyl aminomalonate hydrochloride is used as a pharmaceutical intermediate. Diethyl aminomalonate with formaldehyde generates an azomethine ylide which can undergo cycloadditions with 1,2-dipolarophiles to form pyrrolidines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29224995 |
| Storage Class | 11 - Combustible Solids |





