A0635412
Adamantane , 99% , 281-23-2
Synonym(s):
Adamantane;Tricyclo[3.3.1.1(3,7)]decane
CAS NO.:281-23-2
Empirical Formula: C10H16
Molecular Weight: 136.23
MDL number: MFCD00074719
EINECS: 206-001-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB24.80 | In Stock |
|
| 100G | RMB68.80 | In Stock |
|
| 250g | RMB135.20 | In Stock |
|
| 500G | RMB189.60 | In Stock |
|
| 2.5kg | RMB765.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-212 °C (subl.) (lit.) |
| Boiling point: | 185.55°C (rough estimate) |
| Density | 1,07 g/cm3 |
| refractive index | 1.5680 |
| storage temp. | Store below +30°C. |
| solubility | 0.00021g/l slightly soluble |
| form | Crystals or Crystalline Powder |
| color | White to beige |
| Specific Gravity | 1.07 |
| Water Solubility | Insoluble in water. |
| Merck | 14,149 |
| BRN | 1901173 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C10H16/c1-7-2-9-4-8(1)5-10(3-7)6-9/h7-10H,1-6H2/t7-,8+,9-,10+ |
| InChIKey | ORILYTVJVMAKLC-UHFFFAOYSA-N |
| SMILES | C1[C@H]2C[C@H]3C[C@@H]1C[C@@H](C2)C3 |
| LogP | 4.240 |
| CAS DataBase Reference | 281-23-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Adamantane(281-23-2) |
| EPA Substance Registry System | Tricyclo[3.3.1.13,7]decane (281-23-2) |
Description and Uses
The diamine as curing agent for epoxy resins [US 3053907 (1962 to du Pont)].
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P273 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50 |
| Safety Statements | 24/25-36-26-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | YK0493000 |
| Autoignition Temperature | 287 °C |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29021990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |





