A0637757
Phorbol , 98% , 17673-25-5
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB399.20 | In Stock |
|
| 25mg | RMB719.20 | In Stock |
|
| 100mg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-163° and 233-234°; mp 249-250° |
| alpha | D24 +102° (water); D20 +118° (c = 0.4 in dioxane) |
| Boiling point: | 415.62°C (rough estimate) |
| Density | 1.4 |
| refractive index | 1.4450 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| Water Solubility | Soluble in water |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: slightly soluble; PBS (pH 7.2): 1 mg/ml |
| form | powder to crystal |
| pka | 11.36±0.70(Predicted) |
| color | White to Orange to Green |
| InChIKey | QGVLYPPODPLXMB-UBTYZVCOSA-N |
| SMILES | C1(=O)[C@]2(O)[C@]([H])([C@@]3(O)[C@H](C)[C@@H](O)[C@@]4(O)C(C)(C)[C@@]4([H])[C@]3([H])C=C(CO)C2)C=C1C |
| CAS DataBase Reference | 17673-25-5 |
| EPA Substance Registry System | Phorbol (17673-25-5) |
Description and Uses
Phorbol is a diterpene originally isolated from croton oil. It is used as a starting material for the semisynthesis of various phorbol diesters, which are structurally analogous to diacylglycerol and activate PKC isoforms by associating with their C1 domains.
Phorbol is a plant-derived diterpene that exhibits various biological activities such as its role as tumor promoters through the activation of protein kinase C.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28-36/37/38 |
| Safety Statements | 26-27-36/37/39-45-28 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GZ0600000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29062990 |
| Hazardous Substances Data | 17673-25-5(Hazardous Substances Data) |






