S9080414
≥98%(TLC),powder , 37558-16-0
Synonym(s):
PDBu;PDBu, PKC Activator II;Phorbol-12,13-dibutyrate - CAS 37558-16-0 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB929.28 | In Stock |
|
| 5mg | RMB2633.44 | In Stock |
|
| 10mg | RMB5542.22 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 513.95°C (rough estimate) |
| Density | 1.1270 (rough estimate) |
| refractive index | 1.4480 (estimate) |
| storage temp. | -20°C |
| solubility | H2O: 30 μM |
| pka | 11.15±0.70(Predicted) |
| form | powder |
| color | clear, light yellow, film |
| Water Solubility | H2O: 30μM DMSO: soluble acetone: soluble ethanol: soluble |
| BRN | 6551234 |
| InChIKey | BQJRUJTZSGYBEZ-YVQNUNKESA-N |
| SMILES | CCCC(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C=C(CO)C[C@@]3(O)[C@H]2C=C(C)C3=O)[C@@H]4C(C)(C)[C@]14OC(=O)CCC |
| CAS DataBase Reference | 37558-16-0(CAS DataBase Reference) |
| EPA Substance Registry System | Phorbol 12,13-dibutyrate (37558-16-0) |
Description and Uses
Phorbol 12,13-dibutyrate has been used as a protein kinase C (PKC) activator to study its effects on human organic anion transporter 4 (hOAT4) activity. It has also been used as a PKC activator to analyze its effects on galectin-3 expression and matrix production in HL-1 cells.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H314-H317-H334-H351 |
| Precautionary statements | P202-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2928 |
| WGK Germany | 3 |
| RTECS | EK7767000 |
| F | 8-10 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 2915601990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 2 Oral Carc. 2 Eye Dam. 1 Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 |







