A0639412
N-Acetyl-L-histidine Monohydrate , 99% , 39145-52-3
CAS NO.：39145-52-3
Empirical Formula: C8H13N3O4
Molecular Weight: 215.21
MDL number: MFCD00149320
EINECS: 219-678-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB226.40 | In Stock |
|
| 25G | RMB523.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163 °C |
| alpha | [α]D20 +44～+47° (c=2, H2O) |
| refractive index | 46.5 ° (C=1, H2O) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Sparingly, Heated), Water (Sparingly, Heated, Sonicat |
| form | Powder |
| color | White |
| Water Solubility | Soluble in water. |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1/C8H11N3O3.H2O/c1-5(12)11-7(8(13)14)2-6-3-9-4-10-6;/h3-4,7H,2H2,1H3,(H,9,10)(H,11,12)(H,13,14);1H2/t7-;/s3 |
| InChIKey | PSWSDQRXCOJSFC-WMASNCOMNA-N |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CC1NC=NC=1.O |&1:0,r| |
| LogP | -1.601 (est) |
| CAS DataBase Reference | 39145-52-3 |
Description and Uses
N-acetylhistidine, a novel osmolyte in the lens of Atlantic salmon. An ectotherm homologue of human predicted gene NAT16 encodes histidine N-acetyltransferase responsible for N?±-acetylhistidine synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-28 |
| HS Code | 29332900 |
