A8451212
Z-Dap-OH , 98% , 35761-26-3
Synonym(s):
Nα-Z-L -2,3-Diaminopropionic acid;Z-Dpr-OH
CAS NO.：35761-26-3
Empirical Formula: C11H14N2O4
Molecular Weight: 238.24
MDL number: MFCD00237345
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~240 °C (dec.) |
| Boiling point: | 463.8±45.0 °C(Predicted) |
| alpha | -39 º (1%, 1N HCl) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in dilute acid. |
| pka | 2.86±0.16(Predicted) |
| form | Solid |
| color | White |
| optical activity | [α]20/D 39±1°, c = 1% in 1 M HCl |
| Sensitive | Hygroscopic |
| BRN | 4486950 |
| InChI | InChI=1S/C11H14N2O4/c12-6-9(10(14)15)13-11(16)17-7-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,16)(H,14,15)/t9-/m0/s1 |
| InChIKey | FOXRXVSTFGNURG-VIFPVBQESA-N |
| SMILES | C(O)(=O)[C@H](CN)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 35761-26-3(CAS DataBase Reference) |
Description and Uses
Nalpha-Benzyloxycarbonyl-L-2,3-diaminopropionic acid is a important building block for the synthesis of peptides containing DAP residues, e.g. bleomycins, edeines, tuberactinomycins.
