A8451112
Z-Dap(Boc)-OH , 98% , 16947-84-5
Synonym(s):
Nα-Z-Nβ-Boc-L -2,3-diaminopropionic acid;Z-3-(Boc-amino)-L -alanine
CAS NO.:16947-84-5
Empirical Formula: C16H22N2O6
Molecular Weight: 338.36
MDL number: MFCD00237342
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB133.60 | In Stock |
|
| 5g | RMB356.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 548.7±50.0 °C(Predicted) |
| Density | 1.235±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder |
| pka | 3.67±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 12.0±1°, c = 1% in methanol |
| BRN | 3629152 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C16H22N2O6/c1-16(2,3)24-14(21)17-9-12(13(19)20)18-15(22)23-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,21)(H,18,22)(H,19,20)/t12-/m0/s1 |
| InChIKey | WJKGPJRAGHSOLM-LBPRGKRZSA-N |
| SMILES | C(O)(=O)[C@H](CNC(OC(C)(C)C)=O)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 16947-84-5(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






