A0641912
4,4'-Azobis(4-cyanovaleric acid) , 98%, containing about 20%of water , 2638-94-0
Synonym(s):
4,4′-Azobis(4-cyanopentanoic acid);ABCVA;ACVA
CAS NO.:2638-94-0
Empirical Formula: C12H16N4O4
Molecular Weight: 280.28
MDL number: MFCD00002799
EINECS: 220-135-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB248.00 | In Stock |
|
| 250G | RMB635.20 | In Stock |
|
| 500g | RMB912.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-125 °C (dec.) (lit.) |
| Boiling point: | 423°C (rough estimate) |
| Density | 1.2464 (rough estimate) |
| refractive index | 1.6081 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.98±0.10(Predicted) |
| color | White |
| Water Solubility | Soluble in water. |
| Sensitive | Light Sensitive |
| BRN | 1729856 |
| InChI | 1S/C12H16N4O4/c1-11(7-13,5-3-9(17)18)15-16-12(2,8-14)6-4-10(19)20/h3-6H2,1-2H3,(H,17,18)(H,19,20)/b16-15+ |
| InChIKey | VFXXTYGQYWRHJP-FOCLMDBBSA-N |
| SMILES | CC(CCC(O)=O)(\N=N\C(C)(CCC(O)=O)C#N)C#N |
| LogP | 0.8 at 23℃ |
| CAS DataBase Reference | 2638-94-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,4'-Azo-bis(4-cyanopentanoic acid)(2638-94-0) |
| EPA Substance Registry System | 4,4'-Azobis(4-cyanovaleric acid) (2638-94-0) |
Description and Uses
4,4′-Azobis(4-cyanovaleric acid) has been used in the preparation of polystyrene particles by polymerizing styrene in ethyl alcohol.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H242 |
| Precautionary statements | P210-P234-P235-P240-P370+P378-P403 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 15-16-22-24/25-36 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 2 |
| RTECS | YV6190500 |
| F | 4.4-8 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| HS Code | 29270000 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Self-react. D |
| Toxicity | LD50 ipr-mus: 666 mg/kg 85JCAE -,922,86 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Not Permitted as Excepted Quantity |






