A0646212
3-Aminobenzonitrile , 98% , 2237-30-1
Synonym(s):
3-Cyanoaniline
CAS NO.:2237-30-1
Empirical Formula: C7H6N2
Molecular Weight: 118.14
MDL number: MFCD00007756
EINECS: 218-800-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-53 °C(lit.) |
| Boiling point: | 288-290 °C |
| Density | 1.5511 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | 112 °C |
| solubility | soluble in Methanol |
| form | Crystalline Solid |
| pka | 2.75(at 25℃) |
| color | Brown |
| BRN | 636498 |
| InChI | InChI=1S/C7H6N2/c8-5-6-2-1-3-7(9)4-6/h1-4H,9H2 |
| InChIKey | NJXPYZHXZZCTNI-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(N)=C1 |
| CAS DataBase Reference | 2237-30-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 3-amino-(2237-30-1) |
Description and Uses
3-Aminobenzonitrile was used in the synthesis of series of 1-substituted-3(5)-(6-methylpyridin-2-yl)-4-(quinoxalin-6-yl)pyrazoles. It was also used in the preparation of highly substituted γ-lactam analogues of a thiazolidinone follicle stimulating hormone receptor agonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H317 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-43-22-36/37/38 |
| Safety Statements | 36/37-36-26 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | DI2454000 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Skin Sens. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





