A0647312
2-Aminonicotinic acid , 98% , 5345-47-1
Synonym(s):
2-Aminonicotinic acid;2-Aminopyridine-3-carboxylic acid
CAS NO.：5345-47-1
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD00006318
EINECS: 226-296-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB910.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 295-297 °C (dec.)(lit.) |
| Boiling point: | 253.51°C (rough estimate) |
| Density | 1.3471 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO |
| form | Crystalline Powder |
| pka | 2.94±0.10(Predicted) |
| color | Off-white to light yellow |
| Water Solubility | soluble |
| BRN | 119031 |
| InChI | InChI=1S/C6H6N2O2/c7-5-4(6(9)10)2-1-3-8-5/h1-3H,(H2,7,8)(H,9,10) |
| InChIKey | KPIVDNYJNOPGBE-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC=C1C(O)=O |
| CAS DataBase Reference | 5345-47-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Aminonicotinic acid (5345-47-1) |
Description and Uses
2-Aminopyridine-3-carboxylic acid can be used as:
- A ligand to prepare copper(II)-organic coordination compounds.
- A reactant to prepare pyrido[2′,1′:2,3]imidazo[4,5-c]isoquinolines by reacting with trimethylsilyl cyanide and phthalaldehyde.
- A reactant to synthesize organo-soluble and thermally stable poly(thiourea-amide-imide) polymers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
